C21H34N2O7 — CID 58481121
3-(3-acetyl-4-aminophenyl)-N-[3-[2,3-bis(2-hydroxyethoxy)propoxy]propyl]propanamide (PubChem CID 58481121) has the molecular formula C21H34N2O7 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(3-acetyl-4-aminophenyl)-N-[3-[2,3-bis(2-hydroxyethoxy)propoxy]propyl]propanamide.
| Compound Name | 3-(3-acetyl-4-aminophenyl)-N-[3-[2,3-bis(2-hydroxyethoxy)propoxy]propyl]propanamide |
|---|---|
| PubChem CID | 58481121 |
| Molecular Formula | C21H34N2O7 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 3-(3-acetyl-4-aminophenyl)-N-[3-[2,3-bis(2-hydroxyethoxy)propoxy]propyl]propanamide |
| SMILES | CC(=O)c1cc(CCC(=O)NCCCOCC(COCCO)OCCO)ccc1N |
| InChI | InChI=1S/C21H34N2O7/c1-16(26)19-13-17(3-5-20(19)22)4-6-21(27)23-7-2-10-28-14-18(30-12-9-25)15-29-11-8-24/h3,5,13,18,24-25H,2,4,6-12,14-15,22H2,1H3,(H,23,27) |
| InChIKey | ZEMDUMZLGXQYCQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|