C34H58NO7+ — CID 91274950
CID 91274950 (PubChem CID 91274950) has the molecular formula C34H58NO7+ and a molecular weight of 592.84 g/mol.
| Compound Name | CID 91274950 |
|---|---|
| PubChem CID | 91274950 |
| Molecular Formula | C34H58NO7+ |
| Molecular Weight | 592.84 g/mol |
| Exact Mass | 592.42 |
| IUPAC Name | — |
| SMILES | [CH2+]c1ccc(CCC(=O)NCCCOCC(CC(C)(C)OCCC(C)(C)O)C(C)(C)OCCC(C)(C)O)cc1C(C)=O |
| InChI | InChI=1S/C34H57NO7/c1-25-12-13-27(22-29(25)26(2)36)14-15-30(37)35-18-11-19-40-24-28(34(9,10)42-21-17-32(5,6)39)23-33(7,8)41-20-16-31(3,4)38/h12-13,22,28,38-39H,1,11,14-21,23-24H2,2-10H3/p+1 |
| InChIKey | FTVVPFIGQQTQNM-UHFFFAOYSA-O |
| XLogP | 5.45 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|