C23H35NO4 — CID 90864886
3-(3-acetyl-4-ethenylphenyl)-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]propanamide (PubChem CID 90864886) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-(3-acetyl-4-ethenylphenyl)-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]propanamide.
| Compound Name | 3-(3-acetyl-4-ethenylphenyl)-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]propanamide |
|---|---|
| PubChem CID | 90864886 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 3-(3-acetyl-4-ethenylphenyl)-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]propanamide |
| SMILES | C=Cc1ccc(CCC(=O)NCCC(C)(C)OCCC(C)(C)O)cc1C(C)=O |
| InChI | InChI=1S/C23H35NO4/c1-7-19-10-8-18(16-20(19)17(2)25)9-11-21(26)24-14-12-23(5,6)28-15-13-22(3,4)27/h7-8,10,16,27H,1,9,11-15H2,2-6H3,(H,24,26) |
| InChIKey | RKCWNIHBMLUTMS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |