C31H26F3N4OP — CID 58481677
4-diphenylphosphanyl-N-[[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]benzamide (PubChem CID 58481677) has the molecular formula C31H26F3N4OP and a molecular weight of 558.54 g/mol. Its IUPAC name is 4-diphenylphosphanyl-N-[[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]benzamide.
| Compound Name | 4-diphenylphosphanyl-N-[[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58481677 |
| Molecular Formula | C31H26F3N4OP |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 4-diphenylphosphanyl-N-[[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]benzamide |
| SMILES | Cc1cc(Cn2cc(CNC(=O)c3ccc(P(c4ccccc4)c4ccccc4)cc3)nn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H26F3N4OP/c1-22-16-23(18-25(17-22)31(32,33)34)20-38-21-26(36-37-38)19-35-30(39)24-12-14-29(15-13-24)40(27-8-4-2-5-9-27)28-10-6-3-7-11-28/h2-18,21H,19-20H2,1H3,(H,35,39) |
| InChIKey | ZPNRBPHMYOCOHH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|