C26H26F3N5OS — CID 137440635
N-[[1-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]triazol-4-yl]methyl]benzamide (PubChem CID 137440635) has the molecular formula C26H26F3N5OS and a molecular weight of 513.59 g/mol. Its IUPAC name is N-[[1-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]triazol-4-yl]methyl]benzamide.
| Compound Name | N-[[1-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 137440635 |
| Molecular Formula | C26H26F3N5OS |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[[1-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]triazol-4-yl]methyl]benzamide |
| SMILES | O=C(NCc1cn(CCCCCCSc2ccnc3cc(C(F)(F)F)ccc23)nn1)c1ccccc1 |
| InChI | InChI=1S/C26H26F3N5OS/c27-26(28,29)20-10-11-22-23(16-20)30-13-12-24(22)36-15-7-2-1-6-14-34-18-21(32-33-34)17-31-25(35)19-8-4-3-5-9-19/h3-5,8-13,16,18H,1-2,6-7,14-15,17H2,(H,31,35) |
| InChIKey | GTJIAVTUBTTYOV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|