C27H31F3N4OS — CID 137440810
piperazin-1-yl-[4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]phenyl]methanone (PubChem CID 137440810) has the molecular formula C27H31F3N4OS and a molecular weight of 516.63 g/mol. Its IUPAC name is piperazin-1-yl-[4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]phenyl]methanone.
| Compound Name | piperazin-1-yl-[4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]phenyl]methanone |
|---|---|
| PubChem CID | 137440810 |
| Molecular Formula | C27H31F3N4OS |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | piperazin-1-yl-[4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]phenyl]methanone |
| SMILES | O=C(c1ccc(NCCCCCCSc2ccnc3cc(C(F)(F)F)ccc23)cc1)N1CCNCC1 |
| InChI | InChI=1S/C27H31F3N4OS/c28-27(29,30)21-7-10-23-24(19-21)33-13-11-25(23)36-18-4-2-1-3-12-32-22-8-5-20(6-9-22)26(35)34-16-14-31-15-17-34/h5-11,13,19,31-32H,1-4,12,14-18H2 |
| InChIKey | NOONIXGPUVNKTO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|