C33H41F3N4O3S — CID 169178149
tert-butyl 4-[2-methyl-4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]benzoyl]piperazine-1-carboxylate (PubChem CID 169178149) has the molecular formula C33H41F3N4O3S and a molecular weight of 630.78 g/mol. Its IUPAC name is tert-butyl 4-[2-methyl-4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-methyl-4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169178149 |
| Molecular Formula | C33H41F3N4O3S |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | tert-butyl 4-[2-methyl-4-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexylamino]benzoyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(NCCCCCCSc2ccnc3cc(C(F)(F)F)ccc23)ccc1C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H41F3N4O3S/c1-23-21-25(10-12-26(23)30(41)39-16-18-40(19-17-39)31(42)43-32(2,3)4)37-14-7-5-6-8-20-44-29-13-15-38-28-22-24(33(34,35)36)9-11-27(28)29/h9-13,15,21-22,37H,5-8,14,16-20H2,1-4H3 |
| InChIKey | MCUBLHDFVPZSME-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|