C25H25F3N2O5S — CID 137440678
4-[[4-oxo-5-[5-[7-(trifluoromethyl)quinolin-4-yl]sulfanylpentoxy]pyran-2-yl]methyl]morpholin-3-one (PubChem CID 137440678) has the molecular formula C25H25F3N2O5S and a molecular weight of 522.55 g/mol. Its IUPAC name is 4-[[4-oxo-5-[5-[7-(trifluoromethyl)quinolin-4-yl]sulfanylpentoxy]pyran-2-yl]methyl]morpholin-3-one.
| Compound Name | 4-[[4-oxo-5-[5-[7-(trifluoromethyl)quinolin-4-yl]sulfanylpentoxy]pyran-2-yl]methyl]morpholin-3-one |
|---|---|
| PubChem CID | 137440678 |
| Molecular Formula | C25H25F3N2O5S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 4-[[4-oxo-5-[5-[7-(trifluoromethyl)quinolin-4-yl]sulfanylpentoxy]pyran-2-yl]methyl]morpholin-3-one |
| SMILES | O=C1COCCN1Cc1cc(=O)c(OCCCCCSc2ccnc3cc(C(F)(F)F)ccc23)co1 |
| InChI | InChI=1S/C25H25F3N2O5S/c26-25(27,28)17-4-5-19-20(12-17)29-7-6-23(19)36-11-3-1-2-9-34-22-15-35-18(13-21(22)31)14-30-8-10-33-16-24(30)32/h4-7,12-13,15H,1-3,8-11,14,16H2 |
| InChIKey | GRGBMCHSQGUWGA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|