C24H25F3N2O5S — CID 10324061
2-(morpholin-4-ylmethyl)-5-[2-[2-[7-(trifluoromethyl)quinolin-4-yl]sulfanylethoxy]ethoxy]pyran-4-one (PubChem CID 10324061) has the molecular formula C24H25F3N2O5S and a molecular weight of 510.53 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-5-[2-[2-[7-(trifluoromethyl)quinolin-4-yl]sulfanylethoxy]ethoxy]pyran-4-one.
| Compound Name | 2-(morpholin-4-ylmethyl)-5-[2-[2-[7-(trifluoromethyl)quinolin-4-yl]sulfanylethoxy]ethoxy]pyran-4-one |
|---|---|
| PubChem CID | 10324061 |
| Molecular Formula | C24H25F3N2O5S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-5-[2-[2-[7-(trifluoromethyl)quinolin-4-yl]sulfanylethoxy]ethoxy]pyran-4-one |
| SMILES | O=c1cc(CN2CCOCC2)occ1OCCOCCSc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H25F3N2O5S/c25-24(26,27)17-1-2-19-20(13-17)28-4-3-23(19)35-12-11-32-9-10-33-22-16-34-18(14-21(22)30)15-29-5-7-31-8-6-29/h1-4,13-14,16H,5-12,15H2 |
| InChIKey | WRFYYYRLBVOWSG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|