C24H29F3N4OS — CID 137440676
4-[[3-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]imidazol-4-yl]methyl]morpholine (PubChem CID 137440676) has the molecular formula C24H29F3N4OS and a molecular weight of 478.58 g/mol. Its IUPAC name is 4-[[3-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]imidazol-4-yl]methyl]morpholine.
| Compound Name | 4-[[3-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]imidazol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 137440676 |
| Molecular Formula | C24H29F3N4OS |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 4-[[3-[6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexyl]imidazol-4-yl]methyl]morpholine |
| SMILES | FC(F)(F)c1ccc2c(SCCCCCCn3cncc3CN3CCOCC3)ccnc2c1 |
| InChI | InChI=1S/C24H29F3N4OS/c25-24(26,27)19-5-6-21-22(15-19)29-8-7-23(21)33-14-4-2-1-3-9-31-18-28-16-20(31)17-30-10-12-32-13-11-30/h5-8,15-16,18H,1-4,9-14,17H2 |
| InChIKey | QXPLFIZFUXCBLA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|