C25H32F3N3O2S — CID 137440777
1-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]-6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexan-1-one (PubChem CID 137440777) has the molecular formula C25H32F3N3O2S and a molecular weight of 495.61 g/mol. Its IUPAC name is 1-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]-6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexan-1-one.
| Compound Name | 1-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]-6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexan-1-one |
|---|---|
| PubChem CID | 137440777 |
| Molecular Formula | C25H32F3N3O2S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 1-[3-(morpholin-4-ylmethyl)pyrrolidin-1-yl]-6-[7-(trifluoromethyl)quinolin-4-yl]sulfanylhexan-1-one |
| SMILES | O=C(CCCCCSc1ccnc2cc(C(F)(F)F)ccc12)N1CCC(CN2CCOCC2)C1 |
| InChI | InChI=1S/C25H32F3N3O2S/c26-25(27,28)20-5-6-21-22(16-20)29-9-7-23(21)34-15-3-1-2-4-24(32)31-10-8-19(18-31)17-30-11-13-33-14-12-30/h5-7,9,16,19H,1-4,8,10-15,17-18H2 |
| InChIKey | NWKSGASEYBTAKF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|