C22H26F3NO2S — CID 147780105
1-(oxan-4-yl)-7-[7-(trifluoromethyl)quinolin-4-yl]sulfanylheptan-2-one (PubChem CID 147780105) has the molecular formula C22H26F3NO2S and a molecular weight of 425.52 g/mol. Its IUPAC name is 1-(oxan-4-yl)-7-[7-(trifluoromethyl)quinolin-4-yl]sulfanylheptan-2-one.
| Compound Name | 1-(oxan-4-yl)-7-[7-(trifluoromethyl)quinolin-4-yl]sulfanylheptan-2-one |
|---|---|
| PubChem CID | 147780105 |
| Molecular Formula | C22H26F3NO2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-(oxan-4-yl)-7-[7-(trifluoromethyl)quinolin-4-yl]sulfanylheptan-2-one |
| SMILES | O=C(CCCCCSc1ccnc2cc(C(F)(F)F)ccc12)CC1CCOCC1 |
| InChI | InChI=1S/C22H26F3NO2S/c23-22(24,25)17-5-6-19-20(15-17)26-10-7-21(19)29-13-3-1-2-4-18(27)14-16-8-11-28-12-9-16/h5-7,10,15-16H,1-4,8-9,11-14H2 |
| InChIKey | HHPXSDIJSWMPED-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|