C24H30F3N5OS — CID 137440695
4-[6-[4-[(3-methoxypyrrolidin-1-yl)methyl]triazol-1-yl]hexylsulfanyl]-7-(trifluoromethyl)quinoline (PubChem CID 137440695) has the molecular formula C24H30F3N5OS and a molecular weight of 493.60 g/mol. Its IUPAC name is 4-[6-[4-[(3-methoxypyrrolidin-1-yl)methyl]triazol-1-yl]hexylsulfanyl]-7-(trifluoromethyl)quinoline.
| Compound Name | 4-[6-[4-[(3-methoxypyrrolidin-1-yl)methyl]triazol-1-yl]hexylsulfanyl]-7-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 137440695 |
| Molecular Formula | C24H30F3N5OS |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-[6-[4-[(3-methoxypyrrolidin-1-yl)methyl]triazol-1-yl]hexylsulfanyl]-7-(trifluoromethyl)quinoline |
| SMILES | COC1CCN(Cc2cn(CCCCCCSc3ccnc4cc(C(F)(F)F)ccc34)nn2)C1 |
| InChI | InChI=1S/C24H30F3N5OS/c1-33-20-9-12-31(17-20)15-19-16-32(30-29-19)11-4-2-3-5-13-34-23-8-10-28-22-14-18(24(25,26)27)6-7-21(22)23/h6-8,10,14,16,20H,2-5,9,11-13,15,17H2,1H3 |
| InChIKey | GNIPOVKXYNGLLU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|