C14H17ClF2N6 — CID 58484967
(7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine (PubChem CID 58484967) has the molecular formula C14H17ClF2N6 and a molecular weight of 342.78 g/mol. Its IUPAC name is (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine.
| Compound Name | (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine |
|---|---|
| PubChem CID | 58484967 |
| Molecular Formula | C14H17ClF2N6 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine |
| SMILES | [H]/N=C1/[C@@H](CC)N([C@@H]2CCC(F)(F)C2)c2nc(Cl)ncc2N1/C=N/[H] |
| InChI | InChI=1S/C14H17ClF2N6/c1-2-9-11(19)22(7-18)10-6-20-13(15)21-12(10)23(9)8-3-4-14(16,17)5-8/h6-9,18-19H,2-5H2,1H3/b18-7+,19-11-/t8-,9-/m1/s1 |
| InChIKey | JGFAEYQPLMFVIL-OCKDZMDDSA-N |
| XLogP | 3.31 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|