About (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine
(7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine (PubChem CID 58484967) has the molecular formula C14H17ClF2N6
and a molecular weight of 342.78 g/mol. Its IUPAC name is (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine.
Molecular Properties
| Compound Name | (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine |
| PubChem CID | 58484967 |
| Molecular Formula | C14H17ClF2N6 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine |
| SMILES | [H]/N=C1/[C@@H](CC)N([C@@H]2CCC(F)(F)C2)c2nc(Cl)ncc2N1/C=N/[H] |
| InChI | InChI=1S/C14H17ClF2N6/c1-2-9-11(19)22(7-18)10-6-20-13(15)21-12(10)23(9)8-3-4-14(16,17)5-8/h6-9,18-19H,2-5H2,1H3/b18-7+,19-11-/t8-,9-/m1/s1 |
| InChIKey | JGFAEYQPLMFVIL-OCKDZMDDSA-N |
| XLogP | 3.31 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine?
The IUPAC name of (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine (CID 58484967) is (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine.
What is the SMILES notation for (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine?
The canonical SMILES for (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine is [H]/N=C1/[C@@H](CC)N([C@@H]2CCC(F)(F)C2)c2nc(Cl)ncc2N1/C=N/[H].
What is the InChIKey of (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine?
The InChIKey is JGFAEYQPLMFVIL-OCKDZMDDSA-N. The full InChI is InChI=1S/C14H17ClF2N6/c1-2-9-11(19)22(7-18)10-6-20-13(15)21-12(10)23(9)8-3-4-14(16,17)5-8/h6-9,18-19H,2-5H2,1H3/b18-7+,19-11-/t8-,9-/m1/s1.
What are the key properties of (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine?
(7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine has a molecular weight of 342.78 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-2-chloro-8-[(1R)-3,3-difluorocyclopentyl]-7-ethyl-5-methanimidoyl-7H-pteridin-6-imine is sourced from PubChem (CID 58484967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).