C27H34O4 — CID 58489892
methyl 2-ethyl-2,6-dimethyl-6-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl]heptanoate (PubChem CID 58489892) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 2-ethyl-2,6-dimethyl-6-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl]heptanoate.
| Compound Name | methyl 2-ethyl-2,6-dimethyl-6-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl]heptanoate |
|---|---|
| PubChem CID | 58489892 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl 2-ethyl-2,6-dimethyl-6-[4-[(E)-3-phenylprop-2-enoyl]oxyphenyl]heptanoate |
| SMILES | CCC(C)(CCCC(C)(C)c1ccc(OC(=O)/C=C/c2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C27H34O4/c1-6-27(4,25(29)30-5)20-10-19-26(2,3)22-14-16-23(17-15-22)31-24(28)18-13-21-11-8-7-9-12-21/h7-9,11-18H,6,10,19-20H2,1-5H3/b18-13+ |
| InChIKey | GTXCXVGYLOKRHK-QGOAFFKASA-N |
| XLogP | 6.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|