C27H21BrN2O5 — CID 58490096
[(E)-[16-(4-bromobenzoyl)-12-ethyl-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] acetate (PubChem CID 58490096) has the molecular formula C27H21BrN2O5 and a molecular weight of 533.38 g/mol. Its IUPAC name is [(E)-[16-(4-bromobenzoyl)-12-ethyl-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] acetate.
| Compound Name | [(E)-[16-(4-bromobenzoyl)-12-ethyl-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] acetate |
|---|---|
| PubChem CID | 58490096 |
| Molecular Formula | C27H21BrN2O5 |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | [(E)-[16-(4-bromobenzoyl)-12-ethyl-7-oxo-3-oxa-12-azatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),9,13(18),14,16-hexaen-6-ylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccc(Br)cc3)cc2c2c3c(ccc21)C(=O)/C(=N/OC(C)=O)CCO3 |
| InChI | InChI=1S/C27H21BrN2O5/c1-3-30-22-10-6-17(25(32)16-4-7-18(28)8-5-16)14-20(22)24-23(30)11-9-19-26(33)21(29-35-15(2)31)12-13-34-27(19)24/h4-11,14H,3,12-13H2,1-2H3/b29-21+ |
| InChIKey | SBVBVUWOMZFDOS-XHLNEMQHSA-N |
| XLogP | 5.69 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|