C38H39F3N2O2 — CID 58495912
N-butyl-2-[4-[4-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]phenyl]piperidin-1-yl]-2-phenylacetamide (PubChem CID 58495912) has the molecular formula C38H39F3N2O2 and a molecular weight of 612.74 g/mol. Its IUPAC name is N-butyl-2-[4-[4-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]phenyl]piperidin-1-yl]-2-phenylacetamide.
| Compound Name | N-butyl-2-[4-[4-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]phenyl]piperidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 58495912 |
| Molecular Formula | C38H39F3N2O2 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | N-butyl-2-[4-[4-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]phenyl]ethyl]phenyl]piperidin-1-yl]-2-phenylacetamide |
| SMILES | CCCCNC(=O)C(c1ccccc1)N1CCC(c2ccc(CC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C38H39F3N2O2/c1-2-3-23-42-37(45)36(31-9-5-4-6-10-31)43-24-21-29(22-25-43)28-15-13-27(14-16-28)26-35(44)34-12-8-7-11-33(34)30-17-19-32(20-18-30)38(39,40)41/h4-20,29,36H,2-3,21-26H2,1H3,(H,42,45) |
| InChIKey | WKGFNPMLSKSOTO-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|