C22H19ClN4O3 — CID 58496352
N-[3-[[4-(3-chlorophenyl)-2-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]methyl]phenyl]acetamide (PubChem CID 58496352) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is N-[3-[[4-(3-chlorophenyl)-2-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[4-(3-chlorophenyl)-2-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 58496352 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[3-[[4-(3-chlorophenyl)-2-methyl-3,6-dioxo-1H-pyrazolo[4,3-c]pyridin-5-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Cn2c(-c3cccc(Cl)c3)c3c(=O)n(C)[nH]c3cc2=O)c1 |
| InChI | InChI=1S/C22H19ClN4O3/c1-13(28)24-17-8-3-5-14(9-17)12-27-19(29)11-18-20(22(30)26(2)25-18)21(27)15-6-4-7-16(23)10-15/h3-11,25H,12H2,1-2H3,(H,24,28) |
| InChIKey | XCVGEPAWPWANGP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|