C19H22BrClN2O2 — CID 58498663
tert-butyl (2S)-2-[4-(4-bromophenyl)-5-chloro-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58498663) has the molecular formula C19H22BrClN2O2 and a molecular weight of 425.75 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(4-bromophenyl)-5-chloro-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-(4-bromophenyl)-5-chloro-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58498663 |
| Molecular Formula | C19H22BrClN2O2 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | tert-butyl (2S)-2-[4-(4-bromophenyl)-5-chloro-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC(Cl)=C(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H22BrClN2O2/c1-19(2,3)25-18(24)23-10-4-5-16(23)15-11-14(17(21)22-15)12-6-8-13(20)9-7-12/h6-9,16H,4-5,10-11H2,1-3H3/t16-/m0/s1 |
| InChIKey | ZZFZJXFBOXBECE-INIZCTEOSA-N |
| XLogP | 5.60 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|