C10H14O2Se — CID 58500261
1-(1-deuterio-1-protio(113C)ethyl)seleninyl-4-methoxy-2-methylbenzene (PubChem CID 58500261) has the molecular formula C10H14O2Se and a molecular weight of 247.18 g/mol. Its IUPAC name is 1-(1-deuterio-1-protio(113C)ethyl)seleninyl-4-methoxy-2-methylbenzene.
| Compound Name | 1-(1-deuterio-1-protio(113C)ethyl)seleninyl-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 58500261 |
| Molecular Formula | C10H14O2Se |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 1-(1-deuterio-1-protio(113C)ethyl)seleninyl-4-methoxy-2-methylbenzene |
| SMILES | [1H][13C]([2H])(C)[Se](=O)c1ccc(OC)cc1C |
| InChI | InChI=1S/C10H14O2Se/c1-4-13(11)10-6-5-9(12-3)7-8(10)2/h5-7H,4H2,1-3H3/i4+1DH |
| InChIKey | JCNJUZWAEFJPMD-YOQCINDNSA-N |
| XLogP | 1.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|