C15H17ClN6O2 — CID 58502310
4-(2-chlorophenyl)-N-(cyclopenten-1-yl)-N',N'-dimethyl-5-oxotetrazole-1-carbohydrazide (PubChem CID 58502310) has the molecular formula C15H17ClN6O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(cyclopenten-1-yl)-N',N'-dimethyl-5-oxotetrazole-1-carbohydrazide.
| Compound Name | 4-(2-chlorophenyl)-N-(cyclopenten-1-yl)-N',N'-dimethyl-5-oxotetrazole-1-carbohydrazide |
|---|---|
| PubChem CID | 58502310 |
| Molecular Formula | C15H17ClN6O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(cyclopenten-1-yl)-N',N'-dimethyl-5-oxotetrazole-1-carbohydrazide |
| SMILES | CN(C)N(C(=O)n1nnn(-c2ccccc2Cl)c1=O)C1=CCCC1 |
| InChI | InChI=1S/C15H17ClN6O2/c1-19(2)22(11-7-3-4-8-11)15(24)21-14(23)20(17-18-21)13-10-6-5-9-12(13)16/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | WBONBDSMUKUSSD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|