C23H37NO2 — CID 58507015
2-(4-decylphenyl)-1-[(2R,4R)-4-hydroxypiperidin-2-yl]ethanone (PubChem CID 58507015) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 2-(4-decylphenyl)-1-[(2R,4R)-4-hydroxypiperidin-2-yl]ethanone.
| Compound Name | 2-(4-decylphenyl)-1-[(2R,4R)-4-hydroxypiperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 58507015 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 2-(4-decylphenyl)-1-[(2R,4R)-4-hydroxypiperidin-2-yl]ethanone |
| SMILES | CCCCCCCCCCc1ccc(CC(=O)[C@H]2C[C@H](O)CCN2)cc1 |
| InChI | InChI=1S/C23H37NO2/c1-2-3-4-5-6-7-8-9-10-19-11-13-20(14-12-19)17-23(26)22-18-21(25)15-16-24-22/h11-14,21-22,24-25H,2-10,15-18H2,1H3/t21-,22-/m1/s1 |
| InChIKey | VGCRAOKKGXCIPB-FGZHOGPDSA-N |
| XLogP | 4.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|