C20H31NO2 — CID 58507095
1-[(3R)-3-hydroxypyrrolidin-2-yl]-2-(4-octylphenyl)ethanone (PubChem CID 58507095) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 1-[(3R)-3-hydroxypyrrolidin-2-yl]-2-(4-octylphenyl)ethanone.
| Compound Name | 1-[(3R)-3-hydroxypyrrolidin-2-yl]-2-(4-octylphenyl)ethanone |
|---|---|
| PubChem CID | 58507095 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 1-[(3R)-3-hydroxypyrrolidin-2-yl]-2-(4-octylphenyl)ethanone |
| SMILES | CCCCCCCCc1ccc(CC(=O)C2NCC[C@H]2O)cc1 |
| InChI | InChI=1S/C20H31NO2/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)15-19(23)20-18(22)13-14-21-20/h9-12,18,20-22H,2-8,13-15H2,1H3/t18-,20?/m1/s1 |
| InChIKey | CPJAJGDRYFCZEN-QSVWIEALSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|