C31H30N2O5 — CID 58508361
9H-fluoren-9-ylmethyl (6S,8aS)-8-methyl-1,5-dioxo-3-phenyl-6-propan-2-yl-3,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate (PubChem CID 58508361) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (6S,8aS)-8-methyl-1,5-dioxo-3-phenyl-6-propan-2-yl-3,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (6S,8aS)-8-methyl-1,5-dioxo-3-phenyl-6-propan-2-yl-3,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 58508361 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (6S,8aS)-8-methyl-1,5-dioxo-3-phenyl-6-propan-2-yl-3,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate |
| SMILES | CC(C)[C@H]1C(=O)N2C(c3ccccc3)OC(=O)[C@@H]2C(C)N1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H30N2O5/c1-18(2)26-28(34)33-27(30(35)38-29(33)20-11-5-4-6-12-20)19(3)32(26)31(36)37-17-25-23-15-9-7-13-21(23)22-14-8-10-16-24(22)25/h4-16,18-19,25-27,29H,17H2,1-3H3/t19?,26-,27-,29?/m0/s1 |
| InChIKey | DFYDAKJZFGUOSQ-FLKAPNPQSA-N |
| XLogP | 5.12 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |