C24H17BrFN3O2 — CID 58510193
5-bromo-2-[[4-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]benzonitrile (PubChem CID 58510193) has the molecular formula C24H17BrFN3O2 and a molecular weight of 478.32 g/mol. Its IUPAC name is 5-bromo-2-[[4-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 5-bromo-2-[[4-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 58510193 |
| Molecular Formula | C24H17BrFN3O2 |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 5-bromo-2-[[4-[2-(4-fluorophenyl)-1H-imidazol-5-yl]-3-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(OCc2ccc(Br)cc2C#N)ccc1-c1cnc(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C24H17BrFN3O2/c1-30-23-11-20(31-14-16-2-5-18(25)10-17(16)12-27)8-9-21(23)22-13-28-24(29-22)15-3-6-19(26)7-4-15/h2-11,13H,14H2,1H3,(H,28,29) |
| InChIKey | LURKXADFSOVWLT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |