C24H18ClN3O2 — CID 58510218
2-(4-chlorophenyl)-5-[4-[(4-isocyanophenyl)methoxy]-2-methoxyphenyl]-1H-imidazole (PubChem CID 58510218) has the molecular formula C24H18ClN3O2 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[4-[(4-isocyanophenyl)methoxy]-2-methoxyphenyl]-1H-imidazole.
| Compound Name | 2-(4-chlorophenyl)-5-[4-[(4-isocyanophenyl)methoxy]-2-methoxyphenyl]-1H-imidazole |
|---|---|
| PubChem CID | 58510218 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[4-[(4-isocyanophenyl)methoxy]-2-methoxyphenyl]-1H-imidazole |
| SMILES | [C-]#[N+]c1ccc(COc2ccc(-c3cnc(-c4ccc(Cl)cc4)[nH]3)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H18ClN3O2/c1-26-19-9-3-16(4-10-19)15-30-20-11-12-21(23(13-20)29-2)22-14-27-24(28-22)17-5-7-18(25)8-6-17/h3-14H,15H2,2H3,(H,27,28) |
| InChIKey | FCORYWKTJBRAON-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|