C8H12N2 — CID 585150
N,N,2-trimethylpyridin-4-amine (PubChem CID 585150) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N,N,2-trimethylpyridin-4-amine.
| Compound Name | N,N,2-trimethylpyridin-4-amine |
|---|---|
| PubChem CID | 585150 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N,N,2-trimethylpyridin-4-amine |
| SMILES | Cc1cc(N(C)C)ccn1 |
| InChI | InChI=1S/C8H12N2/c1-7-6-8(10(2)3)4-5-9-7/h4-6H,1-3H3 |
| InChIKey | YTQVUCXSUXFTFM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |