C15H22ClNO5 — CID 58517382
1-(4-chloro-3-methoxyanilino)-3-[2-(oxiran-2-ylmethoxy)ethoxy]propan-2-ol (PubChem CID 58517382) has the molecular formula C15H22ClNO5 and a molecular weight of 331.80 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyanilino)-3-[2-(oxiran-2-ylmethoxy)ethoxy]propan-2-ol.
| Compound Name | 1-(4-chloro-3-methoxyanilino)-3-[2-(oxiran-2-ylmethoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 58517382 |
| Molecular Formula | C15H22ClNO5 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(4-chloro-3-methoxyanilino)-3-[2-(oxiran-2-ylmethoxy)ethoxy]propan-2-ol |
| SMILES | COc1cc(NCC(O)COCCOCC2CO2)ccc1Cl |
| InChI | InChI=1S/C15H22ClNO5/c1-19-15-6-11(2-3-14(15)16)17-7-12(18)8-20-4-5-21-9-13-10-22-13/h2-3,6,12-13,17-18H,4-5,7-10H2,1H3 |
| InChIKey | OAEBRISPQLCNKJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|