C14H16N2Si — CID 58517874
imidazo[2,1-a]isoquinolin-8-yl(trimethyl)silane (PubChem CID 58517874) has the molecular formula C14H16N2Si and a molecular weight of 240.38 g/mol. Its IUPAC name is imidazo[2,1-a]isoquinolin-8-yl(trimethyl)silane.
| Compound Name | imidazo[2,1-a]isoquinolin-8-yl(trimethyl)silane |
|---|---|
| PubChem CID | 58517874 |
| Molecular Formula | C14H16N2Si |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | imidazo[2,1-a]isoquinolin-8-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)c1ccc2c(ccn3ccnc23)c1 |
| InChI | InChI=1S/C14H16N2Si/c1-17(2,3)12-4-5-13-11(10-12)6-8-16-9-7-15-14(13)16/h4-10H,1-3H3 |
| InChIKey | IPFHCNRUZHTNIH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|