C9H6N4 — CID 130047223
3,6,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,7,9,11-hexaene (PubChem CID 130047223) has the molecular formula C9H6N4 and a molecular weight of 170.18 g/mol. Its IUPAC name is 3,6,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,7,9,11-hexaene.
| Compound Name | 3,6,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,7,9,11-hexaene |
|---|---|
| PubChem CID | 130047223 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3,6,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,7,9,11-hexaene |
| SMILES | c1cnc2c(ccn3ccnc23)n1 |
| InChI | InChI=1S/C9H6N4/c1-5-13-6-4-12-9(13)8-7(1)10-2-3-11-8/h1-6H |
| InChIKey | VEKDLSFQWDOXHY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |