C35H36N6 — CID 58518453
9-[4,6-bis(5-methyl-2-pyridinyl)-1,3,5-triazin-2-yl]-3,6-dibutylcarbazole (PubChem CID 58518453) has the molecular formula C35H36N6 and a molecular weight of 540.72 g/mol. Its IUPAC name is 9-[4,6-bis(5-methyl-2-pyridinyl)-1,3,5-triazin-2-yl]-3,6-dibutylcarbazole.
| Compound Name | 9-[4,6-bis(5-methyl-2-pyridinyl)-1,3,5-triazin-2-yl]-3,6-dibutylcarbazole |
|---|---|
| PubChem CID | 58518453 |
| Molecular Formula | C35H36N6 |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 9-[4,6-bis(5-methyl-2-pyridinyl)-1,3,5-triazin-2-yl]-3,6-dibutylcarbazole |
| SMILES | CCCCc1ccc2c(c1)c1cc(CCCC)ccc1n2-c1nc(-c2ccc(C)cn2)nc(-c2ccc(C)cn2)n1 |
| InChI | InChI=1S/C35H36N6/c1-5-7-9-25-13-17-31-27(19-25)28-20-26(10-8-6-2)14-18-32(28)41(31)35-39-33(29-15-11-23(3)21-36-29)38-34(40-35)30-16-12-24(4)22-37-30/h11-22H,5-10H2,1-4H3 |
| InChIKey | FRVKWEYLYHVQBD-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |