C43H50N4 — CID 58518448
9-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-3,6-bis(2-methylhexan-2-yl)carbazole (PubChem CID 58518448) has the molecular formula C43H50N4 and a molecular weight of 622.90 g/mol. Its IUPAC name is 9-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-3,6-bis(2-methylhexan-2-yl)carbazole.
| Compound Name | 9-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-3,6-bis(2-methylhexan-2-yl)carbazole |
|---|---|
| PubChem CID | 58518448 |
| Molecular Formula | C43H50N4 |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | 9-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-3,6-bis(2-methylhexan-2-yl)carbazole |
| SMILES | CCCCC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)CCCC)ccc1n2-c1nc(-c2ccc(C)cc2)nc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C43H50N4/c1-9-11-25-42(5,6)33-21-23-37-35(27-33)36-28-34(43(7,8)26-12-10-2)22-24-38(36)47(37)41-45-39(31-17-13-29(3)14-18-31)44-40(46-41)32-19-15-30(4)16-20-32/h13-24,27-28H,9-12,25-26H2,1-8H3 |
| InChIKey | AQSCBXZMOIZRRY-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |