C12H22O4S — CID 58519789
2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylic acid (PubChem CID 58519789) has the molecular formula C12H22O4S and a molecular weight of 271.43 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58519789 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2,2,3,3,4,4-hexadeuterio-1-[(1,1,1-trideuterio-2-methylpropan-2-yl)sulfonylmethyl]cyclohexane-1-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C(C)(C)S(=O)(=O)CC1(C(=O)O)CCC([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C12H22O4S/c1-11(2,3)17(15,16)9-12(10(13)14)7-5-4-6-8-12/h4-9H2,1-3H3,(H,13,14)/i1D3,4D2,5D2,7D2 |
| InChIKey | QILRJWOONIPWLV-DMZVGXKVSA-N |
| XLogP | 2.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |