C12H22O4S — CID 58519802
1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1-carboxylic acid (PubChem CID 58519802) has the molecular formula C12H22O4S and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1-carboxylic acid.
| Compound Name | 1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 58519802 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1-carboxylic acid |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C(CS(=O)(=O)C(C)(C)C)(C(=O)O)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C12H22O4S/c1-11(2,3)17(15,16)9-12(10(13)14)7-5-4-6-8-12/h4-9H2,1-3H3,(H,13,14)/i4D2,5D2,6D2,7D2,8D2 |
| InChIKey | QILRJWOONIPWLV-RCLKHRGYSA-N |
| XLogP | 2.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |