C20H36O5S — CID 58519809
(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoic acid (PubChem CID 58519809) has the molecular formula C20H36O5S and a molecular weight of 398.63 g/mol. Its IUPAC name is (2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoic acid.
| Compound Name | (2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 58519809 |
| Molecular Formula | C20H36O5S |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]-4-oxopentanoic acid |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C(CC(=O)C[C@H](C(=O)O)C(C)(C)C)(CS(=O)(=O)C(C)(C)C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C20H36O5S/c1-18(2,3)16(17(22)23)12-15(21)13-20(10-8-7-9-11-20)14-26(24,25)19(4,5)6/h16H,7-14H2,1-6H3,(H,22,23)/t16-/m1/s1/i7D2,8D2,9D2,10D2,11D2 |
| InChIKey | GASRMUDHHQMMEA-VAFAGQPXSA-N |
| XLogP | 4.25 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |