C36H52N12O6S2 — CID 58520692
[5-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-sulfinooxyphenyl]ethenyl]phenyl] hydrogen sulfite (PubChem CID 58520692) has the molecular formula C36H52N12O6S2 and a molecular weight of 813.02 g/mol. Its IUPAC name is [5-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-sulfinooxyphenyl]ethenyl]phenyl] hydrogen sulfite.
| Compound Name | [5-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-sulfinooxyphenyl]ethenyl]phenyl] hydrogen sulfite |
|---|---|
| PubChem CID | 58520692 |
| Molecular Formula | C36H52N12O6S2 |
| Molecular Weight | 813.02 g/mol |
| Exact Mass | 812.36 |
| IUPAC Name | [5-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]-2-sulfinooxyphenyl]ethenyl]phenyl] hydrogen sulfite |
| SMILES | CCCCNc1nc(NCCCC)nc(Nc2ccc(/C=C/c3ccc(Nc4nc(NCCCC)nc(NCCCC)n4)cc3OS(=O)O)c(OS(=O)O)c2)n1 |
| InChI | InChI=1S/C36H52N12O6S2/c1-5-9-19-37-31-43-32(38-20-10-6-2)46-35(45-31)41-27-17-15-25(29(23-27)53-55(49)50)13-14-26-16-18-28(24-30(26)54-56(51)52)42-36-47-33(39-21-11-7-3)44-34(48-36)40-22-12-8-4/h13-18,23-24H,5-12,19-22H2,1-4H3,(H,49,50)(H,51,52)(H3,37,38,41,43,45,46)(H3,39,40,42,44,47,48)/b14-13+ |
| InChIKey | HTTWFNALEXJBEY-BUHFOSPRSA-N |
| XLogP | 7.59 |
| TPSA | 242.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.02 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|