C8H12O3 — CID 58521114
(1R,3R,4R,5R)-3-methyl-4-(2-tritioethoxy)-6-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 58521114) has the molecular formula C8H12O3 and a molecular weight of 158.19 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3-methyl-4-(2-tritioethoxy)-6-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,3R,4R,5R)-3-methyl-4-(2-tritioethoxy)-6-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 58521114 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (1R,3R,4R,5R)-3-methyl-4-(2-tritioethoxy)-6-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | [3H]CCO[C@H]1[C@H]2O[C@H]2C(=O)[C@@H]1C |
| InChI | InChI=1S/C8H12O3/c1-3-10-6-4(2)5(9)7-8(6)11-7/h4,6-8H,3H2,1-2H3/t4-,6+,7-,8+/m0/s1/i1T |
| InChIKey | LRQFRDNOGNCWLR-XADSNXTPSA-N |
| XLogP | 0.38 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|