C26H28ClF2N5O — CID 58523630
4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 58523630) has the molecular formula C26H28ClF2N5O and a molecular weight of 499.99 g/mol. Its IUPAC name is 4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 58523630 |
| Molecular Formula | C26H28ClF2N5O |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(-c2cnc3c(n2)N(Cc2c(F)ccc(F)c2Cl)CCCC3)cc1 |
| InChI | InChI=1S/C26H28ClF2N5O/c1-33(2)14-12-30-26(35)18-8-6-17(7-9-18)23-15-31-22-5-3-4-13-34(25(22)32-23)16-19-20(28)10-11-21(29)24(19)27/h6-11,15H,3-5,12-14,16H2,1-2H3,(H,30,35) |
| InChIKey | VOSMMGIRENMOEO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|