C28H30ClF2N5O2S — CID 58523608
4-[[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]sulfanyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 58523608) has the molecular formula C28H30ClF2N5O2S and a molecular weight of 574.10 g/mol. Its IUPAC name is 4-[[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]sulfanyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]sulfanyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 58523608 |
| Molecular Formula | C28H30ClF2N5O2S |
| Molecular Weight | 574.10 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 4-[[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b]azepin-3-yl]sulfanyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc(Sc2cnc3c(n2)N(Cc2c(F)ccc(F)c2Cl)CCCC3)cc1 |
| InChI | InChI=1S/C28H30ClF2N5O2S/c29-26-21(22(30)8-9-23(26)31)18-36-11-2-1-3-24-27(36)34-25(17-33-24)39-20-6-4-19(5-7-20)28(37)32-10-12-35-13-15-38-16-14-35/h4-9,17H,1-3,10-16,18H2,(H,32,37) |
| InChIKey | JIIHFGNXCMUUOV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.10 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|