C22H28N4O3 — CID 58527294
[(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]methanol (PubChem CID 58527294) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 58527294 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]methanol |
| SMILES | CC[C@H]1O[C@@](CO)(c2ccc3c(N)ncnn23)[C@](C)(OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C22H28N4O3/c1-4-18-15(2)21(3,28-12-16-8-6-5-7-9-16)22(13-27,29-18)19-11-10-17-20(23)24-14-25-26(17)19/h5-11,14-15,18,27H,4,12-13H2,1-3H3,(H2,23,24,25)/t15-,18-,21-,22+/m1/s1 |
| InChIKey | IHBYMQBZOHCRSZ-SPRUFDBQSA-N |
| XLogP | 2.92 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |