C12H16F3NO — CID 58528719
1-[1-(3,4,5-trifluorophenyl)propylamino]propan-2-ol (PubChem CID 58528719) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-[1-(3,4,5-trifluorophenyl)propylamino]propan-2-ol.
| Compound Name | 1-[1-(3,4,5-trifluorophenyl)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 58528719 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-[1-(3,4,5-trifluorophenyl)propylamino]propan-2-ol |
| SMILES | CCC(NCC(C)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H16F3NO/c1-3-11(16-6-7(2)17)8-4-9(13)12(15)10(14)5-8/h4-5,7,11,16-17H,3,6H2,1-2H3 |
| InChIKey | ACWJRJRCTUFYED-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|