C15H19FN2O2 — CID 58533268
1-[(2S)-1-(6-fluoropyridine-2-carbonyl)pyrrolidin-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 58533268) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-[(2S)-1-(6-fluoropyridine-2-carbonyl)pyrrolidin-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S)-1-(6-fluoropyridine-2-carbonyl)pyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 58533268 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[(2S)-1-(6-fluoropyridine-2-carbonyl)pyrrolidin-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@@H]1CCCN1C(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C15H19FN2O2/c1-15(2,3)13(19)11-7-5-9-18(11)14(20)10-6-4-8-12(16)17-10/h4,6,8,11H,5,7,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | YEUAMQGEDQYPNI-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|