C17H19F5O — CID 58534848
1-(2,3-dimethylcyclohexyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one (PubChem CID 58534848) has the molecular formula C17H19F5O and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one.
| Compound Name | 1-(2,3-dimethylcyclohexyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 58534848 |
| Molecular Formula | C17H19F5O |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(2,3-dimethylcyclohexyl)-3-(2,3,4,5,6-pentafluorophenyl)propan-2-one |
| SMILES | CC1CCCC(CC(=O)Cc2c(F)c(F)c(F)c(F)c2F)C1C |
| InChI | InChI=1S/C17H19F5O/c1-8-4-3-5-10(9(8)2)6-11(23)7-12-13(18)15(20)17(22)16(21)14(12)19/h8-10H,3-7H2,1-2H3 |
| InChIKey | XDIFYOSTCALNTK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|