C23H27N5O7 — CID 58538275
(2R,4S,5R)-2-[[(4R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-6-(2H-tetrazol-5-yl)oxane-3,4,5-triol (PubChem CID 58538275) has the molecular formula C23H27N5O7 and a molecular weight of 485.50 g/mol. Its IUPAC name is (2R,4S,5R)-2-[[(4R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-6-(2H-tetrazol-5-yl)oxane-3,4,5-triol.
| Compound Name | (2R,4S,5R)-2-[[(4R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-6-(2H-tetrazol-5-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58538275 |
| Molecular Formula | C23H27N5O7 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (2R,4S,5R)-2-[[(4R,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-6-(2H-tetrazol-5-yl)oxane-3,4,5-triol |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(O[C@@H]2OC(c4nn[nH]n4)[C@H](O)[C@H](O)C2O)C=CC3[C@H]1C5 |
| InChI | InChI=1S/C23H27N5O7/c1-28-7-6-23-10-3-5-13(20(23)34-18-12(29)4-2-9(14(18)23)8-11(10)28)33-22-17(32)15(30)16(31)19(35-22)21-24-26-27-25-21/h2-5,10-11,13,15-17,19-20,22,29-32H,6-8H2,1H3,(H,24,25,26,27)/t10?,11-,13?,15+,16-,17?,19?,20+,22-,23+/m1/s1 |
| InChIKey | DJELVDVPSZBLIT-KTCVWSIRSA-N |
| XLogP | -1.08 |
| TPSA | 166.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|