C15H29NO7 — CID 58544944
2-[6-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-2-oxohexoxy]acetic acid (PubChem CID 58544944) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[6-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-2-oxohexoxy]acetic acid.
| Compound Name | 2-[6-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-2-oxohexoxy]acetic acid |
|---|---|
| PubChem CID | 58544944 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-[6-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]-2-oxohexoxy]acetic acid |
| SMILES | NCCCOCCOCCOCCCCC(=O)COCC(=O)O |
| InChI | InChI=1S/C15H29NO7/c16-5-3-7-21-9-11-22-10-8-20-6-2-1-4-14(17)12-23-13-15(18)19/h1-13,16H2,(H,18,19) |
| InChIKey | WTWYTQZSJVWVDM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|