C20H23N7O — CID 58557159
1-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]piperidine-4-carbonitrile (PubChem CID 58557159) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]piperidine-4-carbonitrile.
| Compound Name | 1-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 58557159 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[(3R)-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbonyl]piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(C(=O)N2CCC[C@@H](c3ncc4cnc5[nH]ccc5n34)C2)CC1 |
| InChI | InChI=1S/C20H23N7O/c21-10-14-4-8-25(9-5-14)20(28)26-7-1-2-15(13-26)19-24-12-16-11-23-18-17(27(16)19)3-6-22-18/h3,6,11-12,14-15,22H,1-2,4-5,7-9,13H2/t15-/m1/s1 |
| InChIKey | PTJGEHYGJYYDPD-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |