C22H20F3N5O — CID 58557690
[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 58557690) has the molecular formula C22H20F3N5O and a molecular weight of 427.43 g/mol. Its IUPAC name is [(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 58557690 |
| Molecular Formula | C22H20F3N5O |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | [(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@@H]1CCN(C(=O)c2ccc(C(F)(F)F)cc2)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C22H20F3N5O/c1-13-7-9-29(21(31)14-2-4-15(5-3-14)22(23,24)25)12-17(13)20-28-11-16-10-27-19-18(30(16)20)6-8-26-19/h2-6,8,10-11,13,17,26H,7,9,12H2,1H3/t13-,17+/m1/s1 |
| InChIKey | DKACSARZOUQWRP-DYVFJYSZSA-N |
| XLogP | 4.50 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |