C21H20F2N6O — CID 140572433
N-(2,4-difluorophenyl)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxamide (PubChem CID 140572433) has the molecular formula C21H20F2N6O and a molecular weight of 410.43 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 140572433 |
| Molecular Formula | C21H20F2N6O |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2ccc(F)cc2F)CC1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C21H20F2N6O/c1-12-5-7-28(21(30)27-17-3-2-13(22)8-16(17)23)11-15(12)20-26-10-14-9-25-19-18(29(14)20)4-6-24-19/h2-4,6,8-10,12,15,24H,5,7,11H2,1H3,(H,27,30) |
| InChIKey | DYKKQMOCGLDYCG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |