C29H33ClN2O4 — CID 58560993
3-[amino-[4-[2-(4-chlorophenyl)-1-(4-methylphenoxy)hexan-3-yl]benzoyl]amino]propanoic acid (PubChem CID 58560993) has the molecular formula C29H33ClN2O4 and a molecular weight of 509.05 g/mol. Its IUPAC name is 3-[amino-[4-[2-(4-chlorophenyl)-1-(4-methylphenoxy)hexan-3-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[amino-[4-[2-(4-chlorophenyl)-1-(4-methylphenoxy)hexan-3-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58560993 |
| Molecular Formula | C29H33ClN2O4 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 3-[amino-[4-[2-(4-chlorophenyl)-1-(4-methylphenoxy)hexan-3-yl]benzoyl]amino]propanoic acid |
| SMILES | CCCC(c1ccc(C(=O)N(N)CCC(=O)O)cc1)C(COc1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H33ClN2O4/c1-3-4-26(21-7-9-23(10-8-21)29(35)32(31)18-17-28(33)34)27(22-11-13-24(30)14-12-22)19-36-25-15-5-20(2)6-16-25/h5-16,26-27H,3-4,17-19,31H2,1-2H3,(H,33,34) |
| InChIKey | GSCVOHDVOWOSLI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|