C26H27F3N6O3S — CID 58570508
(1S,2R,5R)-1-methyl-5-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 58570508) has the molecular formula C26H27F3N6O3S and a molecular weight of 560.60 g/mol. Its IUPAC name is (1S,2R,5R)-1-methyl-5-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,5R)-1-methyl-5-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 58570508 |
| Molecular Formula | C26H27F3N6O3S |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | (1S,2R,5R)-1-methyl-5-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(N[C@H](C)c2ccc(OC(F)(F)F)cc2)nc(N[C@@H]2CC[C@@H](O)[C@@]2(C)O)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C26H27F3N6O3S/c1-13(15-4-6-16(7-5-15)38-26(27,28)29)31-24-32-14(2)21(23-33-17-12-30-11-10-18(17)39-23)22(35-24)34-19-8-9-20(36)25(19,3)37/h4-7,10-13,19-20,36-37H,8-9H2,1-3H3,(H2,31,32,34,35)/t13-,19-,20-,25+/m1/s1 |
| InChIKey | GCUHLVZYHPYKJV-DCTISGRASA-N |
| XLogP | 5.21 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |